C26H35N3O8 — CID 118225829
3-ethoxy-5-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid (PubChem CID 118225829) has the molecular formula C26H35N3O8 and a molecular weight of 517.58 g/mol. Its IUPAC name is 3-ethoxy-5-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid.
| Compound Name | 3-ethoxy-5-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 118225829 |
| Molecular Formula | C26H35N3O8 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 3-ethoxy-5-[5-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]furan-2-yl]benzoic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)O)c2)o1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C26H35N3O8/c1-4-7-8-9-20(21(5-2)29(35)16-30)24(31)27-15-28-25(32)23-11-10-22(37-23)17-12-18(26(33)34)14-19(13-17)36-6-3/h10-14,16,20-21,35H,4-9,15H2,1-3H3,(H,27,31)(H,28,32)(H,33,34)/t20-,21-/m1/s1 |
| InChIKey | MPNREWYPAXFODC-NHCUHLMSSA-N |
| XLogP | 3.67 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|