C21H27N3O5 — CID 118226146
N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-phenylfuran-2-carboxamide (PubChem CID 118226146) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-phenylfuran-2-carboxamide.
| Compound Name | N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 118226146 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-[[[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]amino]methyl]-5-phenylfuran-2-carboxamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NCNC(=O)c1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H27N3O5/c1-2-3-5-10-17(13-24(28)15-25)20(26)22-14-23-21(27)19-12-11-18(29-19)16-8-6-4-7-9-16/h4,6-9,11-12,15,17,28H,2-3,5,10,13-14H2,1H3,(H,22,26)(H,23,27)/t17-/m1/s1 |
| InChIKey | LGAPOOHXNBODQQ-QGZVFWFLSA-N |
| XLogP | 2.79 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|