C32H32FN7O5S2 — CID 118226914
2-[6-[4-[(N'-benzyl-N-cyanocarbamimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(2-methoxyethylsulfonyl)acetamide (PubChem CID 118226914) has the molecular formula C32H32FN7O5S2 and a molecular weight of 677.78 g/mol. Its IUPAC name is 2-[6-[4-[(N'-benzyl-N-cyanocarbamimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(2-methoxyethylsulfonyl)acetamide.
| Compound Name | 2-[6-[4-[(N'-benzyl-N-cyanocarbamimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(2-methoxyethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 118226914 |
| Molecular Formula | C32H32FN7O5S2 |
| Molecular Weight | 677.78 g/mol |
| Exact Mass | 677.19 |
| IUPAC Name | 2-[6-[4-[(N'-benzyl-N-cyanocarbamimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(2-methoxyethylsulfonyl)acetamide |
| SMILES | COCCS(=O)(=O)C(C(=O)NCC(=O)NC1CC1)c1nc2cc(F)c(-c3ccc(N/C(=N/Cc4ccccc4)NC#N)cc3)cc2s1 |
| InChI | InChI=1S/C32H32FN7O5S2/c1-45-13-14-47(43,44)29(30(42)35-18-28(41)38-22-11-12-22)31-40-26-16-25(33)24(15-27(26)46-31)21-7-9-23(10-8-21)39-32(37-19-34)36-17-20-5-3-2-4-6-20/h2-10,15-16,22,29H,11-14,17-18H2,1H3,(H,35,42)(H,38,41)(H2,36,37,39) |
| InChIKey | HZQJPQSHHHDIDN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 174.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.78 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|