C32H32FN7O5S2 — CID 118226916
2-[6-[4-[benzyl-(N'-cyanocarbamimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(2-methoxyethylsulfonyl)acetamide (PubChem CID 118226916) has the molecular formula C32H32FN7O5S2 and a molecular weight of 677.78 g/mol. Its IUPAC name is 2-[6-[4-[benzyl-(N'-cyanocarbamimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(2-methoxyethylsulfonyl)acetamide.
| Compound Name | 2-[6-[4-[benzyl-(N'-cyanocarbamimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(2-methoxyethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 118226916 |
| Molecular Formula | C32H32FN7O5S2 |
| Molecular Weight | 677.78 g/mol |
| Exact Mass | 677.19 |
| IUPAC Name | 2-[6-[4-[benzyl-(N'-cyanocarbamimidoyl)amino]phenyl]-5-fluoro-1,3-benzothiazol-2-yl]-N-[2-(cyclopropylamino)-2-oxoethyl]-2-(2-methoxyethylsulfonyl)acetamide |
| SMILES | COCCS(=O)(=O)C(C(=O)NCC(=O)NC1CC1)c1nc2cc(F)c(-c3ccc(N(Cc4ccccc4)/C(N)=N/C#N)cc3)cc2s1 |
| InChI | InChI=1S/C32H32FN7O5S2/c1-45-13-14-47(43,44)29(30(42)36-17-28(41)38-22-9-10-22)31-39-26-16-25(33)24(15-27(26)46-31)21-7-11-23(12-8-21)40(32(35)37-19-34)18-20-5-3-2-4-6-20/h2-8,11-12,15-16,22,29H,9-10,13-14,17-18H2,1H3,(H2,35,37)(H,36,42)(H,38,41) |
| InChIKey | WBSKVGOKPBGIIS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 179.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|