C24H25F2N7O5S2 — CID 144885747
N-[2-(cyclopropylamino)-2-oxoethyl]-2-[5-fluoro-6-[3-fluoro-4-(N-hydrazinylidenecarbamimidoyl)phenyl]-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)acetamide (PubChem CID 144885747) has the molecular formula C24H25F2N7O5S2 and a molecular weight of 593.64 g/mol. Its IUPAC name is N-[2-(cyclopropylamino)-2-oxoethyl]-2-[5-fluoro-6-[3-fluoro-4-(N-hydrazinylidenecarbamimidoyl)phenyl]-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)acetamide.
| Compound Name | N-[2-(cyclopropylamino)-2-oxoethyl]-2-[5-fluoro-6-[3-fluoro-4-(N-hydrazinylidenecarbamimidoyl)phenyl]-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 144885747 |
| Molecular Formula | C24H25F2N7O5S2 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | N-[2-(cyclopropylamino)-2-oxoethyl]-2-[5-fluoro-6-[3-fluoro-4-(N-hydrazinylidenecarbamimidoyl)phenyl]-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)acetamide |
| SMILES | [H]/N=C(\N=N\N)c1ccc(-c2cc3sc(C(C(=O)NCC(=O)NC4CC4)S(=O)(=O)CCOC)nc3cc2F)cc1F |
| InChI | InChI=1S/C24H25F2N7O5S2/c1-38-6-7-40(36,37)21(23(35)29-11-20(34)30-13-3-4-13)24-31-18-10-17(26)15(9-19(18)39-24)12-2-5-14(16(25)8-12)22(27)32-33-28/h2,5,8-10,13,21H,3-4,6-7,11H2,1H3,(H,29,35)(H,30,34)(H3,27,28,32) |
| InChIKey | CIXHJVNSWJAHRU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 189.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|