C15H11F3N2S — CID 11822979
2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1H-benzimidazole (PubChem CID 11822979) has the molecular formula C15H11F3N2S and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1H-benzimidazole.
| Compound Name | 2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 11822979 |
| Molecular Formula | C15H11F3N2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-1H-benzimidazole |
| SMILES | FC(F)(F)c1ccc(CSc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C15H11F3N2S/c16-15(17,18)11-7-5-10(6-8-11)9-21-14-19-12-3-1-2-4-13(12)20-14/h1-8H,9H2,(H,19,20) |
| InChIKey | JUAXJCTWTHXKOQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |