C11H20INO — CID 11823016
(2S,3S,5R)-5-(iodomethyl)-2-propan-2-yl-3-prop-2-enylpyrrolidin-3-ol (PubChem CID 11823016) has the molecular formula C11H20INO and a molecular weight of 309.19 g/mol. Its IUPAC name is (2S,3S,5R)-5-(iodomethyl)-2-propan-2-yl-3-prop-2-enylpyrrolidin-3-ol.
| Compound Name | (2S,3S,5R)-5-(iodomethyl)-2-propan-2-yl-3-prop-2-enylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 11823016 |
| Molecular Formula | C11H20INO |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (2S,3S,5R)-5-(iodomethyl)-2-propan-2-yl-3-prop-2-enylpyrrolidin-3-ol |
| SMILES | C=CC[C@]1(O)C[C@H](CI)N[C@H]1C(C)C |
| InChI | InChI=1S/C11H20INO/c1-4-5-11(14)6-9(7-12)13-10(11)8(2)3/h4,8-10,13-14H,1,5-7H2,2-3H3/t9-,10+,11+/m1/s1 |
| InChIKey | RUSBEJYOJWDYFK-VWYCJHECSA-N |
| XLogP | 2.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|