C9H16INO — CID 15342439
(2S,3S,5R)-5-(iodomethyl)-2-methyl-3-prop-2-enylpyrrolidin-3-ol (PubChem CID 15342439) has the molecular formula C9H16INO and a molecular weight of 281.14 g/mol. Its IUPAC name is (2S,3S,5R)-5-(iodomethyl)-2-methyl-3-prop-2-enylpyrrolidin-3-ol.
| Compound Name | (2S,3S,5R)-5-(iodomethyl)-2-methyl-3-prop-2-enylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 15342439 |
| Molecular Formula | C9H16INO |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | (2S,3S,5R)-5-(iodomethyl)-2-methyl-3-prop-2-enylpyrrolidin-3-ol |
| SMILES | C=CC[C@]1(O)C[C@H](CI)N[C@H]1C |
| InChI | InChI=1S/C9H16INO/c1-3-4-9(12)5-8(6-10)11-7(9)2/h3,7-8,11-12H,1,4-6H2,2H3/t7-,8+,9-/m0/s1 |
| InChIKey | DDNWUTQZPLCJDN-YIZRAAEISA-N |
| XLogP | 1.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|