C31H46O6 — CID 118231076
[(1R,3S,7R,11S,12R,14S,15R,16S)-7,15-dihydroxy-9-(hydroxymethyl)-5,13,13,16-tetramethyl-6-oxo-14-pentacyclo[9.5.0.01,3.03,7.012,14]hexadeca-4,9-dienyl] decanoate (PubChem CID 118231076) has the molecular formula C31H46O6 and a molecular weight of 514.70 g/mol. Its IUPAC name is [(1R,3S,7R,11S,12R,14S,15R,16S)-7,15-dihydroxy-9-(hydroxymethyl)-5,13,13,16-tetramethyl-6-oxo-14-pentacyclo[9.5.0.01,3.03,7.012,14]hexadeca-4,9-dienyl] decanoate.
| Compound Name | [(1R,3S,7R,11S,12R,14S,15R,16S)-7,15-dihydroxy-9-(hydroxymethyl)-5,13,13,16-tetramethyl-6-oxo-14-pentacyclo[9.5.0.01,3.03,7.012,14]hexadeca-4,9-dienyl] decanoate |
|---|---|
| PubChem CID | 118231076 |
| Molecular Formula | C31H46O6 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | [(1R,3S,7R,11S,12R,14S,15R,16S)-7,15-dihydroxy-9-(hydroxymethyl)-5,13,13,16-tetramethyl-6-oxo-14-pentacyclo[9.5.0.01,3.03,7.012,14]hexadeca-4,9-dienyl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@]12[C@H](O)[C@@H](C)[C@]34C[C@]35C=C(C)C(=O)[C@@]5(O)CC(CO)=C[C@H]4[C@@H]1C2(C)C |
| InChI | InChI=1S/C31H46O6/c1-6-7-8-9-10-11-12-13-23(33)37-31-24(27(31,4)5)22-14-21(17-32)16-30(36)25(34)19(2)15-28(30)18-29(22,28)20(3)26(31)35/h14-15,20,22,24,26,32,35-36H,6-13,16-18H2,1-5H3/t20-,22+,24-,26-,28-,29+,30+,31-/m1/s1 |
| InChIKey | ABDCAJOQUWTOGD-RVEMKHGESA-N |
| XLogP | 4.65 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|