C30H48O6 — CID 138612312
[(1S,2R,6R,10S,11R,13S,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] decanoate (PubChem CID 138612312) has the molecular formula C30H48O6 and a molecular weight of 504.71 g/mol. Its IUPAC name is [(1S,2R,6R,10S,11R,13S,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] decanoate.
| Compound Name | [(1S,2R,6R,10S,11R,13S,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] decanoate |
|---|---|
| PubChem CID | 138612312 |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | [(1S,2R,6R,10S,11R,13S,14R,15R)-1,6,14-trihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@]12[C@H](O)[C@@H](C)[C@]3(O)[C@@H]4C=C(C)C[C@@]4(O)CC(CO)=C[C@H]3[C@@H]1C2(C)C |
| InChI | InChI=1S/C30H48O6/c1-6-7-8-9-10-11-12-13-24(32)36-30-25(27(30,4)5)22-15-21(18-31)17-28(34)16-19(2)14-23(28)29(22,35)20(3)26(30)33/h14-15,20,22-23,25-26,31,33-35H,6-13,16-18H2,1-5H3/t20-,22+,23-,25-,26-,28-,29-,30-/m1/s1 |
| InChIKey | KBRYTCKDLGCRLT-IFQBNQEESA-N |
| XLogP | 4.44 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|