C15H25NO6 — CID 11823209
6-O-ethyl 7a-O-methyl (3S,7aR)-3-tert-butyl-5-hydroxy-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate (PubChem CID 11823209) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is 6-O-ethyl 7a-O-methyl (3S,7aR)-3-tert-butyl-5-hydroxy-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate.
| Compound Name | 6-O-ethyl 7a-O-methyl (3S,7aR)-3-tert-butyl-5-hydroxy-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate |
|---|---|
| PubChem CID | 11823209 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 6-O-ethyl 7a-O-methyl (3S,7aR)-3-tert-butyl-5-hydroxy-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate |
| SMILES | CCOC(=O)C1C[C@]2(C(=O)OC)CO[C@@H](C(C)(C)C)N2C1O |
| InChI | InChI=1S/C15H25NO6/c1-6-21-11(18)9-7-15(13(19)20-5)8-22-12(14(2,3)4)16(15)10(9)17/h9-10,12,17H,6-8H2,1-5H3/t9?,10?,12-,15+/m0/s1 |
| InChIKey | HJUSSAUZKDQRJG-DPVGPUGMSA-N |
| XLogP | 0.50 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |