C15H25NO5 — CID 171590795
2-O-tert-butyl 8-O-methyl (2S,3R,8S)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate (PubChem CID 171590795) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-O-tert-butyl 8-O-methyl (2S,3R,8S)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate.
| Compound Name | 2-O-tert-butyl 8-O-methyl (2S,3R,8S)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate |
|---|---|
| PubChem CID | 171590795 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-O-tert-butyl 8-O-methyl (2S,3R,8S)-3-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate |
| SMILES | COC(=O)[C@@]12CCCN1[C@@H](CO)[C@@H](C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C15H25NO5/c1-14(2,3)21-12(18)10-8-15(13(19)20-4)6-5-7-16(15)11(10)9-17/h10-11,17H,5-9H2,1-4H3/t10-,11-,15-/m0/s1 |
| InChIKey | CMIFQUYNDRMTNM-PGUXBMHVSA-N |
| XLogP | 0.72 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |