C22H31NO6 — CID 164922734
8-O-tert-butyl 2-O-methyl (2S,3R,8R)-3-[2-(methoxymethoxy)phenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate (PubChem CID 164922734) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-methyl (2S,3R,8R)-3-[2-(methoxymethoxy)phenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-methyl (2S,3R,8R)-3-[2-(methoxymethoxy)phenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate |
|---|---|
| PubChem CID | 164922734 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 8-O-tert-butyl 2-O-methyl (2S,3R,8R)-3-[2-(methoxymethoxy)phenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate |
| SMILES | COCOc1ccccc1[C@H]1[C@@H](C(=O)OC)C[C@@]2(C(=O)OC(C)(C)C)CCCN12 |
| InChI | InChI=1S/C22H31NO6/c1-21(2,3)29-20(25)22-11-8-12-23(22)18(16(13-22)19(24)27-5)15-9-6-7-10-17(15)28-14-26-4/h6-7,9-10,16,18H,8,11-14H2,1-5H3/t16-,18-,22+/m0/s1 |
| InChIKey | WTTUZSDZVZMIPZ-SGXKBVARSA-N |
| XLogP | 3.08 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|