C34H43NO7 — CID 70698508
2-O,6-O-ditert-butyl 8-O-methyl (2R,3S,5R,6R,8R)-3-(2-methoxyphenyl)-5-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,6,8-tricarboxylate (PubChem CID 70698508) has the molecular formula C34H43NO7 and a molecular weight of 577.72 g/mol. Its IUPAC name is 2-O,6-O-ditert-butyl 8-O-methyl (2R,3S,5R,6R,8R)-3-(2-methoxyphenyl)-5-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,6,8-tricarboxylate.
| Compound Name | 2-O,6-O-ditert-butyl 8-O-methyl (2R,3S,5R,6R,8R)-3-(2-methoxyphenyl)-5-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,6,8-tricarboxylate |
|---|---|
| PubChem CID | 70698508 |
| Molecular Formula | C34H43NO7 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | 2-O,6-O-ditert-butyl 8-O-methyl (2R,3S,5R,6R,8R)-3-(2-methoxyphenyl)-5-[(E)-2-phenylethenyl]-1,2,3,5,6,7-hexahydropyrrolizine-2,6,8-tricarboxylate |
| SMILES | COC(=O)[C@]12C[C@@H](C(=O)OC(C)(C)C)[C@@H](/C=C/c3ccccc3)N1[C@H](c1ccccc1OC)[C@H](C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C34H43NO7/c1-32(2,3)41-29(36)24-20-34(31(38)40-8)21-25(30(37)42-33(4,5)6)28(23-16-12-13-17-27(23)39-7)35(34)26(24)19-18-22-14-10-9-11-15-22/h9-19,24-26,28H,20-21H2,1-8H3/b19-18+/t24-,25-,26-,28-,34-/m1/s1 |
| InChIKey | AYZWLCOHEDWSIM-LVVZQQDKSA-N |
| XLogP | 5.76 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|