C20H35NO5 — CID 171590951
8-O-tert-butyl 2-O-methyl (2S,3S,8R)-3-(2-butoxyethyl)-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate (PubChem CID 171590951) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-methyl (2S,3S,8R)-3-(2-butoxyethyl)-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-methyl (2S,3S,8R)-3-(2-butoxyethyl)-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate |
|---|---|
| PubChem CID | 171590951 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 8-O-tert-butyl 2-O-methyl (2S,3S,8R)-3-(2-butoxyethyl)-1,2,3,5,6,7-hexahydropyrrolizine-2,8-dicarboxylate |
| SMILES | CCCCOCC[C@H]1[C@@H](C(=O)OC)C[C@@]2(C(=O)OC(C)(C)C)CCCN12 |
| InChI | InChI=1S/C20H35NO5/c1-6-7-12-25-13-9-16-15(17(22)24-5)14-20(10-8-11-21(16)20)18(23)26-19(2,3)4/h15-16H,6-14H2,1-5H3/t15-,16-,20+/m0/s1 |
| InChIKey | UMSWYLAOORDYLL-TWOQFEAHSA-N |
| XLogP | 2.93 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|