C30H54N2O8 — CID 175433785
1-butoxycarbonyl-2,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid;1-tert-butylpiperidine (PubChem CID 175433785) has the molecular formula C30H54N2O8 and a molecular weight of 570.77 g/mol. Its IUPAC name is 1-butoxycarbonyl-2,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid;1-tert-butylpiperidine.
| Compound Name | 1-butoxycarbonyl-2,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid;1-tert-butylpiperidine |
|---|---|
| PubChem CID | 175433785 |
| Molecular Formula | C30H54N2O8 |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | 1-butoxycarbonyl-2,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid;1-tert-butylpiperidine |
| SMILES | CC(C)(C)N1CCCCC1.CCCCOC(=O)N1CCC(C(=O)OC(C)(C)C)CC1(C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35NO8.C9H19N/c1-8-9-12-28-18(27)22-11-10-14(15(23)29-19(2,3)4)13-21(22,16(24)25)17(26)30-20(5,6)7;1-9(2,3)10-7-5-4-6-8-10/h14H,8-13H2,1-7H3,(H,24,25);4-8H2,1-3H3 |
| InChIKey | DWVZEPREXFRZHY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|