About tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane
tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane (PubChem CID 177325275) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane.
Molecular Properties
| Compound Name | tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane |
| PubChem CID | 177325275 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane |
| SMILES | CCC.C[C@H]1C[C@@H](C(=O)OC(C)(C)C)CCN1C |
| InChI | InChI=1S/C12H23NO2.C3H8/c1-9-8-10(6-7-13(9)5)11(14)15-12(2,3)4;1-3-2/h9-10H,6-8H2,1-5H3;3H2,1-2H3/t9-,10-;/m0./s1 |
| InChIKey | DFFHTTBWXRZWJX-IYPAPVHQSA-N |
| XLogP | 3.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane?
The IUPAC name of tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane (CID 177325275) is tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane.
What is the SMILES notation for tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane?
The canonical SMILES for tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane is CCC.C[C@H]1C[C@@H](C(=O)OC(C)(C)C)CCN1C.
What is the InChIKey of tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane?
The InChIKey is DFFHTTBWXRZWJX-IYPAPVHQSA-N. The full InChI is InChI=1S/C12H23NO2.C3H8/c1-9-8-10(6-7-13(9)5)11(14)15-12(2,3)4;1-3-2/h9-10H,6-8H2,1-5H3;3H2,1-2H3/t9-,10-;/m0./s1.
What are the key properties of tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane?
tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane has a molecular weight of 257.42 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,4S)-1,2-dimethylpiperidine-4-carboxylate;propane is sourced from PubChem (CID 177325275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).