C20H33NO8 — CID 151020581
1,2,3-tris(butoxycarbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 151020581) has the molecular formula C20H33NO8 and a molecular weight of 415.48 g/mol. Its IUPAC name is 1,2,3-tris(butoxycarbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1,2,3-tris(butoxycarbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 151020581 |
| Molecular Formula | C20H33NO8 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1,2,3-tris(butoxycarbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCCCOC(=O)C1CCN(C(=O)OCCCC)C1(C(=O)O)C(=O)OCCCC |
| InChI | InChI=1S/C20H33NO8/c1-4-7-12-27-16(22)15-10-11-21(19(26)29-14-9-6-3)20(15,17(23)24)18(25)28-13-8-5-2/h15H,4-14H2,1-3H3,(H,23,24) |
| InChIKey | LXZGMFFMVTXWEG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|