C16H23N3O2 — CID 170564992
tert-butyl (1R,6R,8R)-2,10,11-triazatetracyclo[6.6.0.02,6.010,14]tetradeca-11,13-diene-6-carboxylate (PubChem CID 170564992) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is tert-butyl (1R,6R,8R)-2,10,11-triazatetracyclo[6.6.0.02,6.010,14]tetradeca-11,13-diene-6-carboxylate.
| Compound Name | tert-butyl (1R,6R,8R)-2,10,11-triazatetracyclo[6.6.0.02,6.010,14]tetradeca-11,13-diene-6-carboxylate |
|---|---|
| PubChem CID | 170564992 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | tert-butyl (1R,6R,8R)-2,10,11-triazatetracyclo[6.6.0.02,6.010,14]tetradeca-11,13-diene-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]12CCCN1[C@H]1c3ccnn3C[C@H]1C2 |
| InChI | InChI=1S/C16H23N3O2/c1-15(2,3)21-14(20)16-6-4-8-18(16)13-11(9-16)10-19-12(13)5-7-17-19/h5,7,11,13H,4,6,8-10H2,1-3H3/t11-,13-,16-/m1/s1 |
| InChIKey | KLNQEVDROUPBJX-AXAPSJFSSA-N |
| XLogP | 2.13 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |