C16H25N3O3 — CID 170564988
tert-butyl (2R,3S,8S)-2-(hydroxymethyl)-3-(1H-pyrazol-5-yl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate (PubChem CID 170564988) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl (2R,3S,8S)-2-(hydroxymethyl)-3-(1H-pyrazol-5-yl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate.
| Compound Name | tert-butyl (2R,3S,8S)-2-(hydroxymethyl)-3-(1H-pyrazol-5-yl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 170564988 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | tert-butyl (2R,3S,8S)-2-(hydroxymethyl)-3-(1H-pyrazol-5-yl)-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]12CCCN1[C@H](c1ccn[nH]1)[C@H](CO)C2 |
| InChI | InChI=1S/C16H25N3O3/c1-15(2,3)22-14(21)16-6-4-8-19(16)13(11(9-16)10-20)12-5-7-17-18-12/h5,7,11,13,20H,4,6,8-10H2,1-3H3,(H,17,18)/t11-,13-,16-/m0/s1 |
| InChIKey | RPKLBPSIOGZHFB-RBOXIYTFSA-N |
| XLogP | 1.64 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |