C28H36N2O4 — CID 101383196
tert-butyl (2S,3aS)-2-[bis[(1S)-1-phenylethyl]carbamoyl]-3,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3a-carboxylate (PubChem CID 101383196) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is tert-butyl (2S,3aS)-2-[bis[(1S)-1-phenylethyl]carbamoyl]-3,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3a-carboxylate.
| Compound Name | tert-butyl (2S,3aS)-2-[bis[(1S)-1-phenylethyl]carbamoyl]-3,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3a-carboxylate |
|---|---|
| PubChem CID | 101383196 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | tert-butyl (2S,3aS)-2-[bis[(1S)-1-phenylethyl]carbamoyl]-3,4,5,6-tetrahydro-2H-pyrrolo[1,2-b][1,2]oxazole-3a-carboxylate |
| SMILES | C[C@@H](c1ccccc1)N(C(=O)[C@@H]1C[C@]2(C(=O)OC(C)(C)C)CCCN2O1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C28H36N2O4/c1-20(22-13-8-6-9-14-22)30(21(2)23-15-10-7-11-16-23)25(31)24-19-28(17-12-18-29(28)34-24)26(32)33-27(3,4)5/h6-11,13-16,20-21,24H,12,17-19H2,1-5H3/t20-,21-,24-,28-/m0/s1 |
| InChIKey | JHWDOIMNLXFDOW-FMAFCICHSA-N |
| XLogP | 5.22 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |