C20H32N2O7 — CID 24749729
methyl (6R,8aR)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxo-1,2,3,6,7,8-hexahydroindolizine-8a-carboxylate (PubChem CID 24749729) has the molecular formula C20H32N2O7 and a molecular weight of 412.48 g/mol. Its IUPAC name is methyl (6R,8aR)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxo-1,2,3,6,7,8-hexahydroindolizine-8a-carboxylate.
| Compound Name | methyl (6R,8aR)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxo-1,2,3,6,7,8-hexahydroindolizine-8a-carboxylate |
|---|---|
| PubChem CID | 24749729 |
| Molecular Formula | C20H32N2O7 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | methyl (6R,8aR)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxo-1,2,3,6,7,8-hexahydroindolizine-8a-carboxylate |
| SMILES | COC(=O)[C@]12CCCN1C(=O)[C@H](N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C20H32N2O7/c1-18(2,3)28-16(25)22(17(26)29-19(4,5)6)13-9-11-20(15(24)27-7)10-8-12-21(20)14(13)23/h13H,8-12H2,1-7H3/t13-,20-/m1/s1 |
| InChIKey | IRFDTMIGMATEHV-ZUOKHONESA-N |
| XLogP | 2.86 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|