C20H32N2O7 — CID 24749734
6-O-tert-butyl 8a-O-methyl (6R,8aR)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,8-tetrahydro-1H-indolizine-6,8a-dicarboxylate (PubChem CID 24749734) has the molecular formula C20H32N2O7 and a molecular weight of 412.48 g/mol. Its IUPAC name is 6-O-tert-butyl 8a-O-methyl (6R,8aR)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,8-tetrahydro-1H-indolizine-6,8a-dicarboxylate.
| Compound Name | 6-O-tert-butyl 8a-O-methyl (6R,8aR)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,8-tetrahydro-1H-indolizine-6,8a-dicarboxylate |
|---|---|
| PubChem CID | 24749734 |
| Molecular Formula | C20H32N2O7 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 6-O-tert-butyl 8a-O-methyl (6R,8aR)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,8-tetrahydro-1H-indolizine-6,8a-dicarboxylate |
| SMILES | COC(=O)[C@]12CCCN1C(=O)[C@@](NC(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C20H32N2O7/c1-17(2,3)28-15(25)20(21-16(26)29-18(4,5)6)11-10-19(14(24)27-7)9-8-12-22(19)13(20)23/h8-12H2,1-7H3,(H,21,26)/t19-,20-/m1/s1 |
| InChIKey | RUHVTIOMACEDBS-WOJBJXKFSA-N |
| XLogP | 1.92 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|