C16H26N2O7 — CID 146435090
1-O-tert-butyl 3-O-methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopyrrolidine-1,3-dicarboxylate (PubChem CID 146435090) has the molecular formula C16H26N2O7 and a molecular weight of 358.39 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 146435090 |
| Molecular Formula | C16H26N2O7 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopyrrolidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1(NC(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C16H26N2O7/c1-14(2,3)24-12(21)17-16(11(20)23-7)8-9-18(10(16)19)13(22)25-15(4,5)6/h8-9H2,1-7H3,(H,17,21) |
| InChIKey | JSKDKJNDKWORLR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|