C16H15F2N5O — CID 118233431
2-[5-(dimethylamino)-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-5-fluoro-1H-pyrimidin-6-one (PubChem CID 118233431) has the molecular formula C16H15F2N5O and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-[5-(dimethylamino)-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-5-fluoro-1H-pyrimidin-6-one.
| Compound Name | 2-[5-(dimethylamino)-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-5-fluoro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 118233431 |
| Molecular Formula | C16H15F2N5O |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-[5-(dimethylamino)-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-5-fluoro-1H-pyrimidin-6-one |
| SMILES | CN(C)c1cc(-c2ncc(F)c(=O)[nH]2)nn1Cc1ccccc1F |
| InChI | InChI=1S/C16H15F2N5O/c1-22(2)14-7-13(15-19-8-12(18)16(24)20-15)21-23(14)9-10-5-3-4-6-11(10)17/h3-8H,9H2,1-2H3,(H,19,20,24) |
| InChIKey | YEYPJNQRMFIWBN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |