C19H13FN5O2- — CID 140652233
2-[1-[(2-fluorophenyl)methyl]indazol-3-yl]-6-oxo-1H-pyrimidine-5-carboximidate (PubChem CID 140652233) has the molecular formula C19H13FN5O2- and a molecular weight of 362.34 g/mol. Its IUPAC name is 2-[1-[(2-fluorophenyl)methyl]indazol-3-yl]-6-oxo-1H-pyrimidine-5-carboximidate.
| Compound Name | 2-[1-[(2-fluorophenyl)methyl]indazol-3-yl]-6-oxo-1H-pyrimidine-5-carboximidate |
|---|---|
| PubChem CID | 140652233 |
| Molecular Formula | C19H13FN5O2- |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-[1-[(2-fluorophenyl)methyl]indazol-3-yl]-6-oxo-1H-pyrimidine-5-carboximidate |
| SMILES | [H]/N=C(\[O-])c1cnc(-c2nn(Cc3ccccc3F)c3ccccc23)[nH]c1=O |
| InChI | InChI=1S/C19H14FN5O2/c20-14-7-3-1-5-11(14)10-25-15-8-4-2-6-12(15)16(24-25)18-22-9-13(17(21)26)19(27)23-18/h1-9H,10H2,(H2,21,26)(H,22,23,27)/p-1 |
| InChIKey | DGXVKRYBLGADRL-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|