C15H14FN5O2 — CID 137253675
2-[1-[(2-fluorophenyl)methyl]-5-(methylamino)pyrazol-3-yl]-5-hydroxy-1H-pyrimidin-6-one (PubChem CID 137253675) has the molecular formula C15H14FN5O2 and a molecular weight of 315.31 g/mol. Its IUPAC name is 2-[1-[(2-fluorophenyl)methyl]-5-(methylamino)pyrazol-3-yl]-5-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-[1-[(2-fluorophenyl)methyl]-5-(methylamino)pyrazol-3-yl]-5-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137253675 |
| Molecular Formula | C15H14FN5O2 |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[1-[(2-fluorophenyl)methyl]-5-(methylamino)pyrazol-3-yl]-5-hydroxy-1H-pyrimidin-6-one |
| SMILES | CNc1cc(-c2ncc(O)c(=O)[nH]2)nn1Cc1ccccc1F |
| InChI | InChI=1S/C15H14FN5O2/c1-17-13-6-11(14-18-7-12(22)15(23)19-14)20-21(13)8-9-4-2-3-5-10(9)16/h2-7,17,22H,8H2,1H3,(H,18,19,23) |
| InChIKey | MVTDWJTZVFMACY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |