C19H18N4 — CID 118234431
1-pyridin-3-yl-N,N-bis(pyridin-2-ylmethyl)ethenamine (PubChem CID 118234431) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-pyridin-3-yl-N,N-bis(pyridin-2-ylmethyl)ethenamine.
| Compound Name | 1-pyridin-3-yl-N,N-bis(pyridin-2-ylmethyl)ethenamine |
|---|---|
| PubChem CID | 118234431 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-pyridin-3-yl-N,N-bis(pyridin-2-ylmethyl)ethenamine |
| SMILES | C=C(c1cccnc1)N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C19H18N4/c1-16(17-7-6-10-20-13-17)23(14-18-8-2-4-11-21-18)15-19-9-3-5-12-22-19/h2-13H,1,14-15H2 |
| InChIKey | DZTKAKQEWILUCP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |