C22H34N2O3 — CID 118238217
tert-butyl 10-[(4-methoxyphenyl)methylamino]-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 118238217) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is tert-butyl 10-[(4-methoxyphenyl)methylamino]-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 10-[(4-methoxyphenyl)methylamino]-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 118238217 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | tert-butyl 10-[(4-methoxyphenyl)methylamino]-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | COc1ccc(CNC2CN(C(=O)OC(C)(C)C)CCC23CCCC3)cc1 |
| InChI | InChI=1S/C22H34N2O3/c1-21(2,3)27-20(25)24-14-13-22(11-5-6-12-22)19(16-24)23-15-17-7-9-18(26-4)10-8-17/h7-10,19,23H,5-6,11-16H2,1-4H3 |
| InChIKey | RSYUZKNFUVBSRW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |