C23H36N2O3 — CID 175093238
tert-butyl (4R)-4-(N-ethyl-4-methoxyanilino)-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 175093238) has the molecular formula C23H36N2O3 and a molecular weight of 388.55 g/mol. Its IUPAC name is tert-butyl (4R)-4-(N-ethyl-4-methoxyanilino)-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl (4R)-4-(N-ethyl-4-methoxyanilino)-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 175093238 |
| Molecular Formula | C23H36N2O3 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | tert-butyl (4R)-4-(N-ethyl-4-methoxyanilino)-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CCN(c1ccc(OC)cc1)[C@@H]1CCCC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C23H36N2O3/c1-6-25(18-9-11-19(27-5)12-10-18)20-8-7-13-23(20)14-16-24(17-15-23)21(26)28-22(2,3)4/h9-12,20H,6-8,13-17H2,1-5H3/t20-/m1/s1 |
| InChIKey | ATEVZHBYODXROR-HXUWFJFHSA-N |
| XLogP | 5.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|