C13H13BrF3NO — CID 11823892
N-[(2-bromophenyl)methyl]-2-methyl-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 11823892) has the molecular formula C13H13BrF3NO and a molecular weight of 336.15 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2-methyl-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | N-[(2-bromophenyl)methyl]-2-methyl-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 11823892 |
| Molecular Formula | C13H13BrF3NO |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2-methyl-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)N(Cc1ccccc1Br)CC(F)(F)F |
| InChI | InChI=1S/C13H13BrF3NO/c1-9(2)12(19)18(8-13(15,16)17)7-10-5-3-4-6-11(10)14/h3-6H,1,7-8H2,2H3 |
| InChIKey | JXDYTMWBDQMCLQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|