C15H24N6O3 — CID 11823900
(7S)-7-[(1R)-1-hydroxyethyl]-4-(3-morpholin-4-ylpropylamino)-7,8-dihydro-5H-pteridin-6-one (PubChem CID 11823900) has the molecular formula C15H24N6O3 and a molecular weight of 336.40 g/mol. Its IUPAC name is (7S)-7-[(1R)-1-hydroxyethyl]-4-(3-morpholin-4-ylpropylamino)-7,8-dihydro-5H-pteridin-6-one.
| Compound Name | (7S)-7-[(1R)-1-hydroxyethyl]-4-(3-morpholin-4-ylpropylamino)-7,8-dihydro-5H-pteridin-6-one |
|---|---|
| PubChem CID | 11823900 |
| Molecular Formula | C15H24N6O3 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (7S)-7-[(1R)-1-hydroxyethyl]-4-(3-morpholin-4-ylpropylamino)-7,8-dihydro-5H-pteridin-6-one |
| SMILES | C[C@@H](O)[C@@H]1Nc2ncnc(NCCCN3CCOCC3)c2NC1=O |
| InChI | InChI=1S/C15H24N6O3/c1-10(22)11-15(23)20-12-13(17-9-18-14(12)19-11)16-3-2-4-21-5-7-24-8-6-21/h9-11,22H,2-8H2,1H3,(H,20,23)(H2,16,17,18,19)/t10-,11+/m1/s1 |
| InChIKey | GPTDVDDIMRYYCO-MNOVXSKESA-N |
| XLogP | -0.28 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|