C11H20O — CID 118242772
(E,2R,3S)-2-methyl-3-propylhept-4-enal (PubChem CID 118242772) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (E,2R,3S)-2-methyl-3-propylhept-4-enal.
| Compound Name | (E,2R,3S)-2-methyl-3-propylhept-4-enal |
|---|---|
| PubChem CID | 118242772 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (E,2R,3S)-2-methyl-3-propylhept-4-enal |
| SMILES | CC/C=C/C(CCC)[C@@H](C)C=O |
| InChI | InChI=1S/C11H20O/c1-4-6-8-11(7-5-2)10(3)9-12/h6,8-11H,4-5,7H2,1-3H3/b8-6+/t10-,11?/m0/s1 |
| InChIKey | VMWWMUJNOJRLKK-IFXUDBOSSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|