C38H25N5 — CID 118243329
6-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 118243329) has the molecular formula C38H25N5 and a molecular weight of 551.65 g/mol. Its IUPAC name is 6-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 6-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 118243329 |
| Molecular Formula | C38H25N5 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 6-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5ccnc6c5Cc5cccnc5-6)c4)n3)c2)cc1 |
| InChI | InChI=1S/C38H25N5/c1-3-10-25(11-4-1)27-14-7-16-30(22-27)37-41-36(26-12-5-2-6-13-26)42-38(43-37)31-17-8-15-28(23-31)32-19-21-40-35-33(32)24-29-18-9-20-39-34(29)35/h1-23H,24H2 |
| InChIKey | FPCSYEFLUIJSHO-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |