C16H36N2O5 — CID 118243561
1-[2-[2-[2-[bis(2-hydroxypropyl)amino]ethoxy]ethoxy]ethylamino]butan-2-ol (PubChem CID 118243561) has the molecular formula C16H36N2O5 and a molecular weight of 336.47 g/mol. Its IUPAC name is 1-[2-[2-[2-[bis(2-hydroxypropyl)amino]ethoxy]ethoxy]ethylamino]butan-2-ol.
| Compound Name | 1-[2-[2-[2-[bis(2-hydroxypropyl)amino]ethoxy]ethoxy]ethylamino]butan-2-ol |
|---|---|
| PubChem CID | 118243561 |
| Molecular Formula | C16H36N2O5 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 1-[2-[2-[2-[bis(2-hydroxypropyl)amino]ethoxy]ethoxy]ethylamino]butan-2-ol |
| SMILES | CCC(O)CNCCOCCOCCN(CC(C)O)CC(C)O |
| InChI | InChI=1S/C16H36N2O5/c1-4-16(21)11-17-5-7-22-9-10-23-8-6-18(12-14(2)19)13-15(3)20/h14-17,19-21H,4-13H2,1-3H3 |
| InChIKey | GFDLKJLURXJPGH-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|