C14H33N3O3 — CID 118243560
1-[2-[2-[bis(2-hydroxypropyl)amino]ethyl-methylamino]ethylamino]propan-2-ol (PubChem CID 118243560) has the molecular formula C14H33N3O3 and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-[2-[2-[bis(2-hydroxypropyl)amino]ethyl-methylamino]ethylamino]propan-2-ol.
| Compound Name | 1-[2-[2-[bis(2-hydroxypropyl)amino]ethyl-methylamino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 118243560 |
| Molecular Formula | C14H33N3O3 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.25 |
| IUPAC Name | 1-[2-[2-[bis(2-hydroxypropyl)amino]ethyl-methylamino]ethylamino]propan-2-ol |
| SMILES | CC(O)CNCCN(C)CCN(CC(C)O)CC(C)O |
| InChI | InChI=1S/C14H33N3O3/c1-12(18)9-15-5-6-16(4)7-8-17(10-13(2)19)11-14(3)20/h12-15,18-20H,5-11H2,1-4H3 |
| InChIKey | XSRDAAHJMOGRQG-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|