C7H10N2O3 — CID 118245033
3-[2-aminoethyl(methyl)amino]-4-hydroxycyclobut-3-ene-1,2-dione (PubChem CID 118245033) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 3-[2-aminoethyl(methyl)amino]-4-hydroxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[2-aminoethyl(methyl)amino]-4-hydroxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 118245033 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 3-[2-aminoethyl(methyl)amino]-4-hydroxycyclobut-3-ene-1,2-dione |
| SMILES | CN(CCN)c1c(O)c(=O)c1=O |
| InChI | InChI=1S/C7H10N2O3/c1-9(3-2-8)4-5(10)7(12)6(4)11/h10H,2-3,8H2,1H3 |
| InChIKey | CGHHYEXTKPHHGJ-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|