C26H27N5O3 — CID 118246656
5-(2-nitro-5-piperidin-1-ylphenyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrazine-2-carboxamide (PubChem CID 118246656) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 5-(2-nitro-5-piperidin-1-ylphenyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrazine-2-carboxamide.
| Compound Name | 5-(2-nitro-5-piperidin-1-ylphenyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118246656 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 5-(2-nitro-5-piperidin-1-ylphenyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCCc2ccccc21)c1cnc(-c2cc(N3CCCCC3)ccc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C26H27N5O3/c32-26(29-22-10-6-8-18-7-2-3-9-20(18)22)24-17-27-23(16-28-24)21-15-19(11-12-25(21)31(33)34)30-13-4-1-5-14-30/h2-3,7,9,11-12,15-17,22H,1,4-6,8,10,13-14H2,(H,29,32) |
| InChIKey | QIUAYPSPQYKKIZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|