About 4-iodoazepan-3-ol
4-iodoazepan-3-ol (PubChem CID 118248122) has the molecular formula C6H12INO
and a molecular weight of 241.07 g/mol. Its IUPAC name is 4-iodoazepan-3-ol.
Molecular Properties
| Compound Name | 4-iodoazepan-3-ol |
| PubChem CID | 118248122 |
| Molecular Formula | C6H12INO |
| Molecular Weight | 241.07 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 4-iodoazepan-3-ol |
| SMILES | OC1CNCCCC1I |
| InChI | InChI=1S/C6H12INO/c7-5-2-1-3-8-4-6(5)9/h5-6,8-9H,1-4H2 |
| InChIKey | OZANWRTVRJVTJR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.07 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodoazepan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodoazepan-3-ol?
The IUPAC name of 4-iodoazepan-3-ol (CID 118248122) is 4-iodoazepan-3-ol.
What is the SMILES notation for 4-iodoazepan-3-ol?
The canonical SMILES for 4-iodoazepan-3-ol is OC1CNCCCC1I.
What is the InChIKey of 4-iodoazepan-3-ol?
The InChIKey is OZANWRTVRJVTJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12INO/c7-5-2-1-3-8-4-6(5)9/h5-6,8-9H,1-4H2.
What are the key properties of 4-iodoazepan-3-ol?
4-iodoazepan-3-ol has a molecular weight of 241.07 g/mol, XLogP of 0.53, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodoazepan-3-ol is sourced from PubChem (CID 118248122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).