C15H21N5O3 — CID 118248281
4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(2H-triazol-4-ylmethyl)cyclohexane-1-carboxamide (PubChem CID 118248281) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(2H-triazol-4-ylmethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(2H-triazol-4-ylmethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118248281 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(2H-triazol-4-ylmethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCc1cn[nH]n1)C1CCC(CN2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C15H21N5O3/c21-13-5-6-14(22)20(13)9-10-1-3-11(4-2-10)15(23)16-7-12-8-17-19-18-12/h8,10-11H,1-7,9H2,(H,16,23)(H,17,18,19) |
| InChIKey | ONJNIAAFZTZMFL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|