C9H12N4O — CID 131204421
N-(2H-triazol-4-ylmethyl)cyclopent-3-ene-1-carboxamide (PubChem CID 131204421) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is N-(2H-triazol-4-ylmethyl)cyclopent-3-ene-1-carboxamide.
| Compound Name | N-(2H-triazol-4-ylmethyl)cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 131204421 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | N-(2H-triazol-4-ylmethyl)cyclopent-3-ene-1-carboxamide |
| SMILES | O=C(NCc1cn[nH]n1)C1CC=CC1 |
| InChI | InChI=1S/C9H12N4O/c14-9(7-3-1-2-4-7)10-5-8-6-11-13-12-8/h1-2,6-7H,3-5H2,(H,10,14)(H,11,12,13) |
| InChIKey | HQAJQWZYOUKJRS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|