C10H15N5O2 — CID 175902882
(3S)-5-oxo-N-(2H-triazol-4-ylmethyl)azepane-3-carboxamide (PubChem CID 175902882) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is (3S)-5-oxo-N-(2H-triazol-4-ylmethyl)azepane-3-carboxamide.
| Compound Name | (3S)-5-oxo-N-(2H-triazol-4-ylmethyl)azepane-3-carboxamide |
|---|---|
| PubChem CID | 175902882 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (3S)-5-oxo-N-(2H-triazol-4-ylmethyl)azepane-3-carboxamide |
| SMILES | O=C1CCNC[C@@H](C(=O)NCc2cn[nH]n2)C1 |
| InChI | InChI=1S/C10H15N5O2/c16-9-1-2-11-4-7(3-9)10(17)12-5-8-6-13-15-14-8/h6-7,11H,1-5H2,(H,12,17)(H,13,14,15)/t7-/m0/s1 |
| InChIKey | BELRAAVWICUNFR-ZETCQYMHSA-N |
| XLogP | -1.01 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |