C34H20N4O2 — CID 118248412
11-(4,6-diphenyl-1,3,5-triazin-2-yl)isochromeno[3,4-a]carbazol-13-one (PubChem CID 118248412) has the molecular formula C34H20N4O2 and a molecular weight of 516.56 g/mol. Its IUPAC name is 11-(4,6-diphenyl-1,3,5-triazin-2-yl)isochromeno[3,4-a]carbazol-13-one.
| Compound Name | 11-(4,6-diphenyl-1,3,5-triazin-2-yl)isochromeno[3,4-a]carbazol-13-one |
|---|---|
| PubChem CID | 118248412 |
| Molecular Formula | C34H20N4O2 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 11-(4,6-diphenyl-1,3,5-triazin-2-yl)isochromeno[3,4-a]carbazol-13-one |
| SMILES | O=c1oc2c(ccc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c32)c2ccccc12 |
| InChI | InChI=1S/C34H20N4O2/c39-33-27-17-8-7-15-23(27)26-20-19-25-24-16-9-10-18-28(24)38(29(25)30(26)40-33)34-36-31(21-11-3-1-4-12-21)35-32(37-34)22-13-5-2-6-14-22/h1-20H |
| InChIKey | OUBPHNLUUVMOIC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|