C14H11ClN4 — CID 118249117
N-(4-chloro-2-pyridinyl)-7-methyl-1,8-naphthyridin-2-amine (PubChem CID 118249117) has the molecular formula C14H11ClN4 and a molecular weight of 270.72 g/mol. Its IUPAC name is N-(4-chloro-2-pyridinyl)-7-methyl-1,8-naphthyridin-2-amine.
| Compound Name | N-(4-chloro-2-pyridinyl)-7-methyl-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 118249117 |
| Molecular Formula | C14H11ClN4 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-(4-chloro-2-pyridinyl)-7-methyl-1,8-naphthyridin-2-amine |
| SMILES | Cc1ccc2ccc(Nc3cc(Cl)ccn3)nc2n1 |
| InChI | InChI=1S/C14H11ClN4/c1-9-2-3-10-4-5-12(19-14(10)17-9)18-13-8-11(15)6-7-16-13/h2-8H,1H3,(H,16,17,18,19) |
| InChIKey | GABJIYHHTRTXJL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |