C24H22N3O3S- — CID 118249900
2-[(4-cyclopropylphenoxy)methyl]-6-[2-[(sulfinatoamino)methyl]phenyl]-1H-benzimidazole (PubChem CID 118249900) has the molecular formula C24H22N3O3S- and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-[(4-cyclopropylphenoxy)methyl]-6-[2-[(sulfinatoamino)methyl]phenyl]-1H-benzimidazole.
| Compound Name | 2-[(4-cyclopropylphenoxy)methyl]-6-[2-[(sulfinatoamino)methyl]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 118249900 |
| Molecular Formula | C24H22N3O3S- |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-[(4-cyclopropylphenoxy)methyl]-6-[2-[(sulfinatoamino)methyl]phenyl]-1H-benzimidazole |
| SMILES | O=S([O-])NCc1ccccc1-c1ccc2nc(COc3ccc(C4CC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C24H23N3O3S/c28-31(29)25-14-19-3-1-2-4-21(19)18-9-12-22-23(13-18)27-24(26-22)15-30-20-10-7-17(8-11-20)16-5-6-16/h1-4,7-13,16,25H,5-6,14-15H2,(H,26,27)(H,28,29)/p-1 |
| InChIKey | PDKMCLAPJPDACH-UHFFFAOYSA-M |
| XLogP | 4.57 |
| TPSA | 90.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|