C22H44O3Si — CID 11825173
tert-butyl (E)-11-[tert-butyl(dimethyl)silyl]oxydodec-3-enoate (PubChem CID 11825173) has the molecular formula C22H44O3Si and a molecular weight of 384.68 g/mol. Its IUPAC name is tert-butyl (E)-11-[tert-butyl(dimethyl)silyl]oxydodec-3-enoate.
| Compound Name | tert-butyl (E)-11-[tert-butyl(dimethyl)silyl]oxydodec-3-enoate |
|---|---|
| PubChem CID | 11825173 |
| Molecular Formula | C22H44O3Si |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | tert-butyl (E)-11-[tert-butyl(dimethyl)silyl]oxydodec-3-enoate |
| SMILES | CC(CCCCCC/C=C/CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O3Si/c1-19(25-26(8,9)22(5,6)7)17-15-13-11-10-12-14-16-18-20(23)24-21(2,3)4/h14,16,19H,10-13,15,17-18H2,1-9H3/b16-14+ |
| InChIKey | QYNDMGHFDFGLNC-JQIJEIRASA-N |
| XLogP | 7.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|