C24H27FN10O3S — CID 118253481
2-[5-cyano-2-fluoro-3-[4-[(3R,4R)-1,1,4-trihydroxythiolan-3-yl]piperazin-1-yl]anilino]-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazine-7-carbonitrile (PubChem CID 118253481) has the molecular formula C24H27FN10O3S and a molecular weight of 554.61 g/mol. Its IUPAC name is 2-[5-cyano-2-fluoro-3-[4-[(3R,4R)-1,1,4-trihydroxythiolan-3-yl]piperazin-1-yl]anilino]-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazine-7-carbonitrile.
| Compound Name | 2-[5-cyano-2-fluoro-3-[4-[(3R,4R)-1,1,4-trihydroxythiolan-3-yl]piperazin-1-yl]anilino]-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazine-7-carbonitrile |
|---|---|
| PubChem CID | 118253481 |
| Molecular Formula | C24H27FN10O3S |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 2-[5-cyano-2-fluoro-3-[4-[(3R,4R)-1,1,4-trihydroxythiolan-3-yl]piperazin-1-yl]anilino]-4-(cyclopropylamino)imidazo[2,1-f][1,2,4]triazine-7-carbonitrile |
| SMILES | N#Cc1cc(Nc2nc(NC3CC3)c3ncc(C#N)n3n2)c(F)c(N2CCN([C@H]3CS(O)(O)C[C@@H]3O)CC2)c1 |
| InChI | InChI=1S/C24H27FN10O3S/c25-21-17(30-24-31-22(29-15-1-2-15)23-28-11-16(10-27)35(23)32-24)7-14(9-26)8-18(21)33-3-5-34(6-4-33)19-12-39(37,38)13-20(19)36/h7-8,11,15,19-20,36-38H,1-6,12-13H2,(H2,29,30,31,32)/t19-,20-/m0/s1 |
| InChIKey | SSZOIMOYJRQNBN-PMACEKPBSA-N |
| XLogP | 1.94 |
| TPSA | 181.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|