C23H23ClN10O — CID 123623911
3-[(7R,8aR)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-chloro-5-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]benzonitrile (PubChem CID 123623911) has the molecular formula C23H23ClN10O and a molecular weight of 490.96 g/mol. Its IUPAC name is 3-[(7R,8aR)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-chloro-5-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]benzonitrile.
| Compound Name | 3-[(7R,8aR)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-chloro-5-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 123623911 |
| Molecular Formula | C23H23ClN10O |
| Molecular Weight | 490.96 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 3-[(7R,8aR)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-4-chloro-5-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]benzonitrile |
| SMILES | [C-]#[N+]c1cnc2c(NC3CC3)nc(Nc3cc(C#N)cc(N4CCN5C[C@H](O)C[C@@H]5C4)c3Cl)nn12 |
| InChI | InChI=1S/C23H23ClN10O/c1-26-19-10-27-22-21(28-14-2-3-14)30-23(31-34(19)22)29-17-6-13(9-25)7-18(20(17)24)33-5-4-32-12-16(35)8-15(32)11-33/h6-7,10,14-16,35H,2-5,8,11-12H2,(H2,28,29,30,31)/t15-,16-/m1/s1 |
| InChIKey | YCLDQBQVLBYLMT-HZPDHXFCSA-N |
| XLogP | 2.77 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.96 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|