C22H21ClN10O — CID 123209640
4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(4-methyl-2-oxo-1,4-diazepan-1-yl)benzonitrile (PubChem CID 123209640) has the molecular formula C22H21ClN10O and a molecular weight of 476.93 g/mol. Its IUPAC name is 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(4-methyl-2-oxo-1,4-diazepan-1-yl)benzonitrile.
| Compound Name | 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(4-methyl-2-oxo-1,4-diazepan-1-yl)benzonitrile |
|---|---|
| PubChem CID | 123209640 |
| Molecular Formula | C22H21ClN10O |
| Molecular Weight | 476.93 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 4-chloro-3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(4-methyl-2-oxo-1,4-diazepan-1-yl)benzonitrile |
| SMILES | [C-]#[N+]c1cnc2c(NC3CC3)nc(Nc3cc(C#N)cc(N4CCCN(C)CC4=O)c3Cl)nn12 |
| InChI | InChI=1S/C22H21ClN10O/c1-25-17-11-26-21-20(27-14-4-5-14)29-22(30-33(17)21)28-15-8-13(10-24)9-16(19(15)23)32-7-3-6-31(2)12-18(32)34/h8-9,11,14H,3-7,12H2,2H3,(H2,27,28,29,30) |
| InChIKey | DSKQRBAIQHJCHJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.93 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|