C21H20N10O — CID 123639251
3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(4-methyl-2-oxopiperazin-1-yl)benzonitrile (PubChem CID 123639251) has the molecular formula C21H20N10O and a molecular weight of 428.46 g/mol. Its IUPAC name is 3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(4-methyl-2-oxopiperazin-1-yl)benzonitrile.
| Compound Name | 3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(4-methyl-2-oxopiperazin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 123639251 |
| Molecular Formula | C21H20N10O |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-(4-methyl-2-oxopiperazin-1-yl)benzonitrile |
| SMILES | [C-]#[N+]c1cnc2c(NC3CC3)nc(Nc3cc(C#N)cc(N4CCN(C)CC4=O)c3)nn12 |
| InChI | InChI=1S/C21H20N10O/c1-23-17-11-24-20-19(25-14-3-4-14)27-21(28-31(17)20)26-15-7-13(10-22)8-16(9-15)30-6-5-29(2)12-18(30)32/h7-9,11,14H,3-6,12H2,2H3,(H2,25,26,27,28) |
| InChIKey | HXCPPNXSCKQQOC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|